C26H30ClFN6O2 — CID 123310186
8-[3-[4-(5-chloro-2-fluoroanilino)-7-(methylamino)quinazolin-6-yl]oxypropyl]-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 123310186) has the molecular formula C26H30ClFN6O2 and a molecular weight of 513.02 g/mol. Its IUPAC name is 8-[3-[4-(5-chloro-2-fluoroanilino)-7-(methylamino)quinazolin-6-yl]oxypropyl]-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[3-[4-(5-chloro-2-fluoroanilino)-7-(methylamino)quinazolin-6-yl]oxypropyl]-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 123310186 |
| Molecular Formula | C26H30ClFN6O2 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 8-[3-[4-(5-chloro-2-fluoroanilino)-7-(methylamino)quinazolin-6-yl]oxypropyl]-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CNc1cc2ncnc(Nc3cc(Cl)ccc3F)c2cc1OCCCN1CCC2(CCC(=O)N2)CC1 |
| InChI | InChI=1S/C26H30ClFN6O2/c1-29-22-15-20-18(25(31-16-30-20)32-21-13-17(27)3-4-19(21)28)14-23(22)36-12-2-9-34-10-7-26(8-11-34)6-5-24(35)33-26/h3-4,13-16,29H,2,5-12H2,1H3,(H,33,35)(H,30,31,32) |
| InChIKey | PPMNFAIQTHKMAG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|