C26H28ClFN4O5 — CID 70025721
9-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,4-dioxa-9-azaspiro[5.5]undecan-2-one (PubChem CID 70025721) has the molecular formula C26H28ClFN4O5 and a molecular weight of 530.98 g/mol. Its IUPAC name is 9-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,4-dioxa-9-azaspiro[5.5]undecan-2-one.
| Compound Name | 9-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,4-dioxa-9-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 70025721 |
| Molecular Formula | C26H28ClFN4O5 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 9-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,4-dioxa-9-azaspiro[5.5]undecan-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCC2(CC1)COCC(=O)O2 |
| InChI | InChI=1S/C26H28ClFN4O5/c1-34-22-13-21-18(25(30-16-29-21)31-17-3-4-20(28)19(27)11-17)12-23(22)36-10-2-7-32-8-5-26(6-9-32)15-35-14-24(33)37-26/h3-4,11-13,16H,2,5-10,14-15H2,1H3,(H,29,30,31) |
| InChIKey | WPOBQWSRIDKGRH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|