C6H6F12O2 — CID 123313206
1,1,1,2-tetrafluoroethane;1,1,2-trifluoroethyl hypofluorite;2,2,2-trifluoroethyl hypofluorite (PubChem CID 123313206) has the molecular formula C6H6F12O2 and a molecular weight of 338.09 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoroethane;1,1,2-trifluoroethyl hypofluorite;2,2,2-trifluoroethyl hypofluorite.
| Compound Name | 1,1,1,2-tetrafluoroethane;1,1,2-trifluoroethyl hypofluorite;2,2,2-trifluoroethyl hypofluorite |
|---|---|
| PubChem CID | 123313206 |
| Molecular Formula | C6H6F12O2 |
| Molecular Weight | 338.09 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1,1,1,2-tetrafluoroethane;1,1,2-trifluoroethyl hypofluorite;2,2,2-trifluoroethyl hypofluorite |
| SMILES | FCC(F)(F)F.FCC(F)(F)OF.FOCC(F)(F)F |
| InChI | InChI=1S/2C2H2F4O.C2H2F4/c3-2(4,5)1-7-6;3-1-2(4,5)7-6;3-1-2(4,5)6/h2*1H2;1H2 |
| InChIKey | BDEZZYBMINARIY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.09 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |