C24H29N3O2S — CID 123314403
(2-methyl-1,3-thiazol-5-yl)methyl N-(5-amino-1,6-diphenylhexan-2-yl)carbamate (PubChem CID 123314403) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-5-yl)methyl N-(5-amino-1,6-diphenylhexan-2-yl)carbamate.
| Compound Name | (2-methyl-1,3-thiazol-5-yl)methyl N-(5-amino-1,6-diphenylhexan-2-yl)carbamate |
|---|---|
| PubChem CID | 123314403 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2-methyl-1,3-thiazol-5-yl)methyl N-(5-amino-1,6-diphenylhexan-2-yl)carbamate |
| SMILES | Cc1ncc(COC(=O)NC(CCC(N)Cc2ccccc2)Cc2ccccc2)s1 |
| InChI | InChI=1S/C24H29N3O2S/c1-18-26-16-23(30-18)17-29-24(28)27-22(15-20-10-6-3-7-11-20)13-12-21(25)14-19-8-4-2-5-9-19/h2-11,16,21-22H,12-15,17,25H2,1H3,(H,27,28) |
| InChIKey | XEHVTXPRUGMXGR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |