C14H25N3O2PS+ — CID 91198018
[2-amino-5-[(2-methyl-1,3-thiazol-5-yl)methoxycarbonylamino]hexyl]-methyl-methylidenephosphanium (PubChem CID 91198018) has the molecular formula C14H25N3O2PS+ and a molecular weight of 330.41 g/mol. Its IUPAC name is [2-amino-5-[(2-methyl-1,3-thiazol-5-yl)methoxycarbonylamino]hexyl]-methyl-methylidenephosphanium.
| Compound Name | [2-amino-5-[(2-methyl-1,3-thiazol-5-yl)methoxycarbonylamino]hexyl]-methyl-methylidenephosphanium |
|---|---|
| PubChem CID | 91198018 |
| Molecular Formula | C14H25N3O2PS+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [2-amino-5-[(2-methyl-1,3-thiazol-5-yl)methoxycarbonylamino]hexyl]-methyl-methylidenephosphanium |
| SMILES | C=[P+](C)CC(N)CCC(C)NC(=O)OCc1cnc(C)s1 |
| InChI | InChI=1S/C14H24N3O2PS/c1-10(5-6-12(15)9-20(3)4)17-14(18)19-8-13-7-16-11(2)21-13/h7,10,12H,3,5-6,8-9,15H2,1-2,4H3/p+1 |
| InChIKey | JGSHDMOXZCNFIK-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|