C23H31N5O3Si — CID 123321121
2-[5-[[5-[C-(2-iminoethyl)-N-(2-trimethylsilylethoxymethyl)carbonimidoyl]-2-pyridinyl]oxy]indazol-2-yl]ethanol (PubChem CID 123321121) has the molecular formula C23H31N5O3Si and a molecular weight of 453.62 g/mol. Its IUPAC name is 2-[5-[[5-[C-(2-iminoethyl)-N-(2-trimethylsilylethoxymethyl)carbonimidoyl]-2-pyridinyl]oxy]indazol-2-yl]ethanol.
| Compound Name | 2-[5-[[5-[C-(2-iminoethyl)-N-(2-trimethylsilylethoxymethyl)carbonimidoyl]-2-pyridinyl]oxy]indazol-2-yl]ethanol |
|---|---|
| PubChem CID | 123321121 |
| Molecular Formula | C23H31N5O3Si |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[5-[[5-[C-(2-iminoethyl)-N-(2-trimethylsilylethoxymethyl)carbonimidoyl]-2-pyridinyl]oxy]indazol-2-yl]ethanol |
| SMILES | [H]/N=C/CC(=NCOCC[Si](C)(C)C)c1ccc(Oc2ccc3nn(CCO)cc3c2)nc1 |
| InChI | InChI=1S/C23H31N5O3Si/c1-32(2,3)13-12-30-17-26-21(8-9-24)18-4-7-23(25-15-18)31-20-5-6-22-19(14-20)16-28(27-22)10-11-29/h4-7,9,14-16,24,29H,8,10-13,17H2,1-3H3/b24-9+,26-21? |
| InChIKey | SJFUBJVJZKVBHY-RWMFAOCGSA-N |
| XLogP | 4.36 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|