C23H29ClN4O2Si — CID 123306956
1-[4-[2-(chloromethyl)imidazo[1,2-a]pyridin-6-yl]oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine (PubChem CID 123306956) has the molecular formula C23H29ClN4O2Si and a molecular weight of 457.05 g/mol. Its IUPAC name is 1-[4-[2-(chloromethyl)imidazo[1,2-a]pyridin-6-yl]oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine.
| Compound Name | 1-[4-[2-(chloromethyl)imidazo[1,2-a]pyridin-6-yl]oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123306956 |
| Molecular Formula | C23H29ClN4O2Si |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[4-[2-(chloromethyl)imidazo[1,2-a]pyridin-6-yl]oxyphenyl]-N-(2-trimethylsilylethoxymethyl)propane-1,3-diimine |
| SMILES | [H]/N=C/CC(=NCOCC[Si](C)(C)C)c1ccc(Oc2ccc3nc(CCl)cn3c2)cc1 |
| InChI | InChI=1S/C23H29ClN4O2Si/c1-31(2,3)13-12-29-17-26-22(10-11-25)18-4-6-20(7-5-18)30-21-8-9-23-27-19(14-24)15-28(23)16-21/h4-9,11,15-16,25H,10,12-14,17H2,1-3H3/b25-11+,26-22? |
| InChIKey | RMOCYEUHMMZEDH-GFHGEBNDSA-N |
| XLogP | 6.01 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|