C30H33N2O2+ — CID 123321963
2-(1-butyl-5-ethylindol-1-ium-3-ylidene)-4-(1-butylindol-3-yl)cyclobutane-1,3-dione (PubChem CID 123321963) has the molecular formula C30H33N2O2+ and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-(1-butyl-5-ethylindol-1-ium-3-ylidene)-4-(1-butylindol-3-yl)cyclobutane-1,3-dione.
| Compound Name | 2-(1-butyl-5-ethylindol-1-ium-3-ylidene)-4-(1-butylindol-3-yl)cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 123321963 |
| Molecular Formula | C30H33N2O2+ |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 2-(1-butyl-5-ethylindol-1-ium-3-ylidene)-4-(1-butylindol-3-yl)cyclobutane-1,3-dione |
| SMILES | CCCCn1cc(C2C(=O)C(=C3C=[N+](CCCC)c4ccc(CC)cc43)C2=O)c2ccccc21 |
| InChI | InChI=1S/C30H33N2O2/c1-4-7-15-31-18-23(21-11-9-10-12-25(21)31)27-29(33)28(30(27)34)24-19-32(16-8-5-2)26-14-13-20(6-3)17-22(24)26/h9-14,17-19,27H,4-8,15-16H2,1-3H3/q+1/b28-24- |
| InChIKey | COFPHAAFHIGIRI-COOPMVRXSA-N |
| XLogP | 6.22 |
| TPSA | 42.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|