C16H23N — CID 123322196
4-butyl-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene (PubChem CID 123322196) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 4-butyl-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene.
| Compound Name | 4-butyl-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene |
|---|---|
| PubChem CID | 123322196 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4-butyl-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene |
| SMILES | CCCCN1CC2C3C=CC(C4C=CC43)C2C1 |
| InChI | InChI=1S/C16H23N/c1-2-3-8-17-9-15-13-6-7-14(16(15)10-17)12-5-4-11(12)13/h4-7,11-16H,2-3,8-10H2,1H3 |
| InChIKey | WOLSMTMDLQDXED-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|