C24H31N5O6 — CID 123326444
1-(dimethylamino)-4,6a-dihydroxy-7-imino-10-[methyl(propyl)amino]-5,6,9-trioxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 123326444) has the molecular formula C24H31N5O6 and a molecular weight of 485.54 g/mol. Its IUPAC name is 1-(dimethylamino)-4,6a-dihydroxy-7-imino-10-[methyl(propyl)amino]-5,6,9-trioxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | 1-(dimethylamino)-4,6a-dihydroxy-7-imino-10-[methyl(propyl)amino]-5,6,9-trioxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 123326444 |
| Molecular Formula | C24H31N5O6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 1-(dimethylamino)-4,6a-dihydroxy-7-imino-10-[methyl(propyl)amino]-5,6,9-trioxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)CCC)C2CC3Cc4c(N(C)C)ncc(O)c4C(=O)C3C(=O)C12O |
| InChI | InChI=1S/C24H31N5O6/c1-5-6-29(4)17-12-8-10-7-11-15(13(30)9-27-23(11)28(2)3)18(31)14(10)21(33)24(12,35)20(25)16(19(17)32)22(26)34/h9-10,12,14,16-17,25,30,35H,5-8H2,1-4H3,(H2,26,34)/b25-20+ |
| InChIKey | NAJVAFODURAOIG-LKUDQCMESA-N |
| XLogP | -0.44 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|