C10H16O3 — CID 123327681
4-methyl-3,4,6,7,8,8a-hexahydro-2H-chromene-2,7-diol (PubChem CID 123327681) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-methyl-3,4,6,7,8,8a-hexahydro-2H-chromene-2,7-diol.
| Compound Name | 4-methyl-3,4,6,7,8,8a-hexahydro-2H-chromene-2,7-diol |
|---|---|
| PubChem CID | 123327681 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-methyl-3,4,6,7,8,8a-hexahydro-2H-chromene-2,7-diol |
| SMILES | CC1CC(O)OC2CC(O)CC=C12 |
| InChI | InChI=1S/C10H16O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h3,6-7,9-12H,2,4-5H2,1H3 |
| InChIKey | IIWGHEZZJKPOET-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|