C19H30O4 — CID 59033088
6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxane-2,4-diol (PubChem CID 59033088) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxane-2,4-diol.
| Compound Name | 6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxane-2,4-diol |
|---|---|
| PubChem CID | 59033088 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 6-[2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxane-2,4-diol |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CCC3CC(O)CC(O)O3)[C@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C19H30O4/c1-11-7-13-4-3-12(2)16(19(13)17(21)8-11)6-5-15-9-14(20)10-18(22)23-15/h3-4,7,11-12,14-22H,5-6,8-10H2,1-2H3/t11-,12-,14?,15?,16-,17-,18?,19-/m0/s1 |
| InChIKey | NATSLKLLVIUUOA-GXCVJRBSSA-N |
| XLogP | 2.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |