C22H36 — CID 123330599
3-(4-ethenylcyclohex-2-en-1-yl)-1-pentan-2-yl-6-propylcyclohexene (PubChem CID 123330599) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 3-(4-ethenylcyclohex-2-en-1-yl)-1-pentan-2-yl-6-propylcyclohexene.
| Compound Name | 3-(4-ethenylcyclohex-2-en-1-yl)-1-pentan-2-yl-6-propylcyclohexene |
|---|---|
| PubChem CID | 123330599 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 3-(4-ethenylcyclohex-2-en-1-yl)-1-pentan-2-yl-6-propylcyclohexene |
| SMILES | C=CC1C=CC(C2C=C(C(C)CCC)C(CCC)CC2)CC1 |
| InChI | InChI=1S/C22H36/c1-5-8-17(4)22-16-21(15-14-20(22)9-6-2)19-12-10-18(7-3)11-13-19/h7,10,12,16-21H,3,5-6,8-9,11,13-15H2,1-2,4H3 |
| InChIKey | ZGUXDOGXHUEWKC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|