C23H32N3OS2+ — CID 123334730
N-methyl-N-[3-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide (PubChem CID 123334730) has the molecular formula C23H32N3OS2+ and a molecular weight of 430.66 g/mol. Its IUPAC name is N-methyl-N-[3-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide.
| Compound Name | N-methyl-N-[3-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide |
|---|---|
| PubChem CID | 123334730 |
| Molecular Formula | C23H32N3OS2+ |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-methyl-N-[3-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide |
| SMILES | CN(CCCN(C)c1ccc(C=Cc2cc[n+](C)cc2)cc1)C(=O)C(CS)CS |
| InChI | InChI=1S/C23H31N3OS2/c1-24-15-11-20(12-16-24)6-5-19-7-9-22(10-8-19)25(2)13-4-14-26(3)23(27)21(17-28)18-29/h5-12,15-16,21H,4,13-14,17-18H2,1-3H3,(H-,28,29)/p+1 |
| InChIKey | DRGSVODGWOTOJT-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 27.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|