C19H23N2OS+ — CID 91166613
S-[2-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyl] ethanethioate (PubChem CID 91166613) has the molecular formula C19H23N2OS+ and a molecular weight of 327.47 g/mol. Its IUPAC name is S-[2-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyl] ethanethioate.
| Compound Name | S-[2-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 91166613 |
| Molecular Formula | C19H23N2OS+ |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | S-[2-[N-methyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(C)c1ccc(C=Cc2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C19H23N2OS/c1-16(22)23-15-14-21(3)19-8-6-17(7-9-19)4-5-18-10-12-20(2)13-11-18/h4-13H,14-15H2,1-3H3/q+1 |
| InChIKey | MRODGDLIZSIVNE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|