C32H56O2Si — CID 123336247
(6R)-6-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one (PubChem CID 123336247) has the molecular formula C32H56O2Si and a molecular weight of 500.88 g/mol. Its IUPAC name is (6R)-6-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one.
| Compound Name | (6R)-6-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one |
|---|---|
| PubChem CID | 123336247 |
| Molecular Formula | C32H56O2Si |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | (6R)-6-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one |
| SMILES | CC(=O)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC([Si](C)(C)C(C)(C)C)CC(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H56O2Si/c1-21(11-10-12-22(2)33)26-15-16-27-25-14-13-23-19-24(35(8,9)30(3,4)5)20-29(34)32(23,7)28(25)17-18-31(26,27)6/h13,21,24-29,34H,10-12,14-20H2,1-9H3/t21-,24?,25+,26-,27+,28+,29?,31-,32+/m1/s1 |
| InChIKey | YOYZPWYCFBHYIA-ZQZFZBGUSA-N |
| XLogP | 8.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|