C16H23NO5 — CID 123343890
1-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydro-1H-furo[3,2-d][1,3]oxazol-5-yl)ethane-1,2-diol (PubChem CID 123343890) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydro-1H-furo[3,2-d][1,3]oxazol-5-yl)ethane-1,2-diol.
| Compound Name | 1-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydro-1H-furo[3,2-d][1,3]oxazol-5-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 123343890 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydro-1H-furo[3,2-d][1,3]oxazol-5-yl)ethane-1,2-diol |
| SMILES | CC1(C)NC2C(OC(C(O)CO)C2OCc2ccccc2)O1 |
| InChI | InChI=1S/C16H23NO5/c1-16(2)17-12-14(20-9-10-6-4-3-5-7-10)13(11(19)8-18)21-15(12)22-16/h3-7,11-15,17-19H,8-9H2,1-2H3 |
| InChIKey | KLAVUKVMAVXDRG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |