C32H48O4 — CID 123345208
methyl 2,2,6a,6b,8a,9,9,12a-octamethyl-10,14-dioxo-3,4,5,6,7,8,11,12,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 123345208) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is methyl 2,2,6a,6b,8a,9,9,12a-octamethyl-10,14-dioxo-3,4,5,6,7,8,11,12,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl 2,2,6a,6b,8a,9,9,12a-octamethyl-10,14-dioxo-3,4,5,6,7,8,11,12,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 123345208 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | methyl 2,2,6a,6b,8a,9,9,12a-octamethyl-10,14-dioxo-3,4,5,6,7,8,11,12,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)C12CCC(C)(C)CC1C1C(=O)C=C3C(C)(CCC4(C)C(C)(C)C(=O)CCC34C)C1(C)CC2 |
| InChI | InChI=1S/C32H48O4/c1-26(2)12-16-32(25(35)36-9)17-14-30(7)24(20(32)19-26)21(33)18-22-28(30,5)13-15-31(8)27(3,4)23(34)10-11-29(22,31)6/h18,20,24H,10-17,19H2,1-9H3 |
| InChIKey | JNNNPDBFHDPICP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |