C38H50O6 — CID 138568154
4a-O-benzyl 8a-O-methyl (4S,6aS,6bR,8aS,12aR,14bR)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-1,2,4,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-4a,8a-dicarboxylate (PubChem CID 138568154) has the molecular formula C38H50O6 and a molecular weight of 602.81 g/mol. Its IUPAC name is 4a-O-benzyl 8a-O-methyl (4S,6aS,6bR,8aS,12aR,14bR)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-1,2,4,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-4a,8a-dicarboxylate.
| Compound Name | 4a-O-benzyl 8a-O-methyl (4S,6aS,6bR,8aS,12aR,14bR)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-1,2,4,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-4a,8a-dicarboxylate |
|---|---|
| PubChem CID | 138568154 |
| Molecular Formula | C38H50O6 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 4a-O-benzyl 8a-O-methyl (4S,6aS,6bR,8aS,12aR,14bR)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-1,2,4,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-4a,8a-dicarboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@@H]1C1C(=O)C=C3[C@@]4(C)CCC(=O)[C@@H](C)C4(C(=O)OCc4ccccc4)CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C38H50O6/c1-24-27(39)13-14-35(5)29-21-28(40)30-26-22-33(2,3)15-18-37(26,31(41)43-7)19-16-36(30,6)34(29,4)17-20-38(24,35)32(42)44-23-25-11-9-8-10-12-25/h8-12,21,24,26,30H,13-20,22-23H2,1-7H3/t24-,26-,30?,34-,35-,36-,37+,38?/m1/s1 |
| InChIKey | AIUBTKAWWAZDQB-IIKGMSQMSA-N |
| XLogP | 7.43 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |