C6H11N3O — CID 123350880
2-amino-6-ethyl-4,5-dihydropyrimidin-4-ol (PubChem CID 123350880) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-amino-6-ethyl-4,5-dihydropyrimidin-4-ol.
| Compound Name | 2-amino-6-ethyl-4,5-dihydropyrimidin-4-ol |
|---|---|
| PubChem CID | 123350880 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2-amino-6-ethyl-4,5-dihydropyrimidin-4-ol |
| SMILES | CCC1=NC(N)=NC(O)C1 |
| InChI | InChI=1S/C6H11N3O/c1-2-4-3-5(10)9-6(7)8-4/h5,10H,2-3H2,1H3,(H2,7,9) |
| InChIKey | VAUWYYZYHORMQH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |