C6H11N3 — CID 123764758
6-ethyl-4-methyl-4,5-dihydrotriazine (PubChem CID 123764758) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-ethyl-4-methyl-4,5-dihydrotriazine.
| Compound Name | 6-ethyl-4-methyl-4,5-dihydrotriazine |
|---|---|
| PubChem CID | 123764758 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 6-ethyl-4-methyl-4,5-dihydrotriazine |
| SMILES | CCC1=NN=NC(C)C1 |
| InChI | InChI=1S/C6H11N3/c1-3-6-4-5(2)7-9-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | HTWBZRYNMUKBRH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |