C15H23N3 — CID 102027303
(1S,4S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,7,9-trien-6-amine (PubChem CID 102027303) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (1S,4S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,7,9-trien-6-amine.
| Compound Name | (1S,4S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,7,9-trien-6-amine |
|---|---|
| PubChem CID | 102027303 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (1S,4S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,7,9-trien-6-amine |
| SMILES | CCCCC1=C(C)C[C@@H]2CC[C@@H]3N=C(N)N=C1[C@H]23 |
| InChI | InChI=1S/C15H23N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h10,12-13H,3-8H2,1-2H3,(H2,16,17)/t10-,12-,13+/m0/s1 |
| InChIKey | OLGGXWJBHJJRGB-WCFLWFBJSA-N |
| XLogP | 3.06 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |