C27H54ClN7O — CID 123351804
3,3-diamino-2-(8-chloro-1,4-diethyl-4-methylazonan-2-yl)-N-[5-methyl-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide (PubChem CID 123351804) has the molecular formula C27H54ClN7O and a molecular weight of 528.23 g/mol. Its IUPAC name is 3,3-diamino-2-(8-chloro-1,4-diethyl-4-methylazonan-2-yl)-N-[5-methyl-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(8-chloro-1,4-diethyl-4-methylazonan-2-yl)-N-[5-methyl-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123351804 |
| Molecular Formula | C27H54ClN7O |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 527.41 |
| IUPAC Name | 3,3-diamino-2-(8-chloro-1,4-diethyl-4-methylazonan-2-yl)-N-[5-methyl-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CCN1CC(Cl)CCCC(C)(CC)CC1C(C(=O)NC1CNCC(C)C1N1CCN(C)CC1)C(N)N |
| InChI | InChI=1S/C27H54ClN7O/c1-6-27(4)10-8-9-20(28)18-34(7-2)22(15-27)23(25(29)30)26(36)32-21-17-31-16-19(3)24(21)35-13-11-33(5)12-14-35/h19-25,31H,6-18,29-30H2,1-5H3,(H,32,36) |
| InChIKey | DNUIAJILKYBHSD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|