C23H22ClN5O4S2 — CID 123355310
5-[3-chloro-5-[4-ethyl-5-[4-(1,2-oxazol-3-yl)phenyl]-1,3-oxazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 123355310) has the molecular formula C23H22ClN5O4S2 and a molecular weight of 532.05 g/mol. Its IUPAC name is 5-[3-chloro-5-[4-ethyl-5-[4-(1,2-oxazol-3-yl)phenyl]-1,3-oxazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | 5-[3-chloro-5-[4-ethyl-5-[4-(1,2-oxazol-3-yl)phenyl]-1,3-oxazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 123355310 |
| Molecular Formula | C23H22ClN5O4S2 |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 5-[3-chloro-5-[4-ethyl-5-[4-(1,2-oxazol-3-yl)phenyl]-1,3-oxazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CCc1nc(-c2cc(Cl)c(C3(C)CS(=O)(=O)N(C)C(N)=N3)s2)oc1-c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C23H22ClN5O4S2/c1-4-16-19(14-7-5-13(6-8-14)17-9-10-32-28-17)33-21(26-16)18-11-15(24)20(34-18)23(2)12-35(30,31)29(3)22(25)27-23/h5-11H,4,12H2,1-3H3,(H2,25,27) |
| InChIKey | FVGXCUXCEXSPFD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |