C14H16 — CID 123358545
6-cyclohexa-2,5-dien-1-yl-1,2,3,3a-tetrahydropentalene (PubChem CID 123358545) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 6-cyclohexa-2,5-dien-1-yl-1,2,3,3a-tetrahydropentalene.
| Compound Name | 6-cyclohexa-2,5-dien-1-yl-1,2,3,3a-tetrahydropentalene |
|---|---|
| PubChem CID | 123358545 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 6-cyclohexa-2,5-dien-1-yl-1,2,3,3a-tetrahydropentalene |
| SMILES | C1=CC(C2=C3CCCC3C=C2)C=CC1 |
| InChI | InChI=1S/C14H16/c1-2-5-11(6-3-1)14-10-9-12-7-4-8-13(12)14/h2-3,5-6,9-12H,1,4,7-8H2 |
| InChIKey | VHDGJGVUUIQYIG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|