C20H28Si — CID 20749060
dimethyl-(4,5,6,7-tetrahydro-3aH-inden-1-yl)-(4,5,6,7-tetrahydro-3H-inden-1-yl)silane (PubChem CID 20749060) has the molecular formula C20H28Si and a molecular weight of 296.53 g/mol. Its IUPAC name is dimethyl-(4,5,6,7-tetrahydro-3aH-inden-1-yl)-(4,5,6,7-tetrahydro-3H-inden-1-yl)silane.
| Compound Name | dimethyl-(4,5,6,7-tetrahydro-3aH-inden-1-yl)-(4,5,6,7-tetrahydro-3H-inden-1-yl)silane |
|---|---|
| PubChem CID | 20749060 |
| Molecular Formula | C20H28Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | dimethyl-(4,5,6,7-tetrahydro-3aH-inden-1-yl)-(4,5,6,7-tetrahydro-3H-inden-1-yl)silane |
| SMILES | C[Si](C)(C1=CCC2=C1CCCC2)C1=C2CCCCC2C=C1 |
| InChI | InChI=1S/C20H28Si/c1-21(2,19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h11,13-15H,3-10,12H2,1-2H3 |
| InChIKey | FSDMLTFJEKVNIW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|