C17H16O — CID 14899682
tetracyclo[8.7.0.02,6.012,17]heptadeca-1,7,12,14,16-pentaen-11-one (PubChem CID 14899682) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is tetracyclo[8.7.0.02,6.012,17]heptadeca-1,7,12,14,16-pentaen-11-one.
| Compound Name | tetracyclo[8.7.0.02,6.012,17]heptadeca-1,7,12,14,16-pentaen-11-one |
|---|---|
| PubChem CID | 14899682 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | tetracyclo[8.7.0.02,6.012,17]heptadeca-1,7,12,14,16-pentaen-11-one |
| SMILES | O=C1c2ccccc2C2=C3CCCC3C=CCC12 |
| InChI | InChI=1S/C17H16O/c18-17-14-8-2-1-7-13(14)16-12-9-3-5-11(12)6-4-10-15(16)17/h1-2,4,6-8,11,15H,3,5,9-10H2 |
| InChIKey | QXPBHXLJZPGCIH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|