C23H19FN2O5S — CID 123359051
4-[1-(benzenesulfonyl)-4-[(4-fluorophenyl)methyl]pyrrole-3-carbonyl]-1-methylpyrrolidine-2,3-dione (PubChem CID 123359051) has the molecular formula C23H19FN2O5S and a molecular weight of 454.48 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-4-[(4-fluorophenyl)methyl]pyrrole-3-carbonyl]-1-methylpyrrolidine-2,3-dione.
| Compound Name | 4-[1-(benzenesulfonyl)-4-[(4-fluorophenyl)methyl]pyrrole-3-carbonyl]-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123359051 |
| Molecular Formula | C23H19FN2O5S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-4-[(4-fluorophenyl)methyl]pyrrole-3-carbonyl]-1-methylpyrrolidine-2,3-dione |
| SMILES | CN1CC(C(=O)c2cn(S(=O)(=O)c3ccccc3)cc2Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C23H19FN2O5S/c1-25-13-20(22(28)23(25)29)21(27)19-14-26(32(30,31)18-5-3-2-4-6-18)12-16(19)11-15-7-9-17(24)10-8-15/h2-10,12,14,20H,11,13H2,1H3 |
| InChIKey | VVGBEUBPKYATAK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|