C11H19N — CID 123361932
(4Z)-N,4,5-trimethylocta-1,4-dien-3-imine (PubChem CID 123361932) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (4Z)-N,4,5-trimethylocta-1,4-dien-3-imine.
| Compound Name | (4Z)-N,4,5-trimethylocta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123361932 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (4Z)-N,4,5-trimethylocta-1,4-dien-3-imine |
| SMILES | C=CC(=N\C)/C(C)=C(/C)CCC |
| InChI | InChI=1S/C11H19N/c1-6-8-9(3)10(4)11(7-2)12-5/h7H,2,6,8H2,1,3-5H3/b10-9-,12-11+ |
| InChIKey | AHOLKKFEFUXDAE-XAZJVICWSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|