C30H33N5O4 — CID 123363192
3-[[1-[3-[(2,2-dimethyl-4-phenylpentanoyl)amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzamide (PubChem CID 123363192) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is 3-[[1-[3-[(2,2-dimethyl-4-phenylpentanoyl)amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzamide.
| Compound Name | 3-[[1-[3-[(2,2-dimethyl-4-phenylpentanoyl)amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 123363192 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 3-[[1-[3-[(2,2-dimethyl-4-phenylpentanoyl)amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzamide |
| SMILES | CC(=O)C(/N=N/c1cccc(C(N)=O)c1)C(=O)Nc1cccc(NC(=O)C(C)(C)CC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C30H33N5O4/c1-19(21-10-6-5-7-11-21)18-30(3,4)29(39)33-24-14-9-13-23(17-24)32-28(38)26(20(2)36)35-34-25-15-8-12-22(16-25)27(31)37/h5-17,19,26H,18H2,1-4H3,(H2,31,37)(H,32,38)(H,33,39)/b35-34+ |
| InChIKey | VSNUAACGRIILKQ-XAHDOWKMSA-N |
| XLogP | 5.62 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|