C36H43N5O5 — CID 158071735
3-[[3-hydroxy-1-[3-[[5-methyl-6-oxo-2-(3-phenylpentyl)heptanoyl]amino]anilino]-1-oxobut-2-en-2-yl]diazenyl]benzamide (PubChem CID 158071735) has the molecular formula C36H43N5O5 and a molecular weight of 625.77 g/mol. Its IUPAC name is 3-[[3-hydroxy-1-[3-[[5-methyl-6-oxo-2-(3-phenylpentyl)heptanoyl]amino]anilino]-1-oxobut-2-en-2-yl]diazenyl]benzamide.
| Compound Name | 3-[[3-hydroxy-1-[3-[[5-methyl-6-oxo-2-(3-phenylpentyl)heptanoyl]amino]anilino]-1-oxobut-2-en-2-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 158071735 |
| Molecular Formula | C36H43N5O5 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | 3-[[3-hydroxy-1-[3-[[5-methyl-6-oxo-2-(3-phenylpentyl)heptanoyl]amino]anilino]-1-oxobut-2-en-2-yl]diazenyl]benzamide |
| SMILES | CCC(CCC(CCC(C)C(C)=O)C(=O)Nc1cccc(NC(=O)C(/N=N/c2cccc(C(N)=O)c2)=C(C)O)c1)c1ccccc1 |
| InChI | InChI=1S/C36H43N5O5/c1-5-26(27-11-7-6-8-12-27)19-20-28(18-17-23(2)24(3)42)35(45)38-30-14-10-15-31(22-30)39-36(46)33(25(4)43)41-40-32-16-9-13-29(21-32)34(37)44/h6-16,21-23,26,28,43H,5,17-20H2,1-4H3,(H2,37,44)(H,38,45)(H,39,46)/b33-25?,41-40+ |
| InChIKey | JZOJBMPTGSUAIA-CREGVMHNSA-N |
| XLogP | 7.83 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|