C20H19N5O4 — CID 123447137
3-[[1,3-dioxo-1-[3-(prop-2-enoylamino)anilino]butan-2-yl]diazenyl]benzamide (PubChem CID 123447137) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-[[1,3-dioxo-1-[3-(prop-2-enoylamino)anilino]butan-2-yl]diazenyl]benzamide.
| Compound Name | 3-[[1,3-dioxo-1-[3-(prop-2-enoylamino)anilino]butan-2-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 123447137 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[[1,3-dioxo-1-[3-(prop-2-enoylamino)anilino]butan-2-yl]diazenyl]benzamide |
| SMILES | C=CC(=O)Nc1cccc(NC(=O)C(/N=N/c2cccc(C(N)=O)c2)C(C)=O)c1 |
| InChI | InChI=1S/C20H19N5O4/c1-3-17(27)22-14-7-5-8-15(11-14)23-20(29)18(12(2)26)25-24-16-9-4-6-13(10-16)19(21)28/h3-11,18H,1H2,2H3,(H2,21,28)(H,22,27)(H,23,29)/b25-24+ |
| InChIKey | WZBUTWPGNRVILR-OCOZRVBESA-N |
| XLogP | 2.59 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|