C36H43N5O6 — CID 158214242
methyl 5-[[3-[[2-[(3-carbamoylphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]phenyl]carbamoyl]-2-methyl-8-phenyldecanoate (PubChem CID 158214242) has the molecular formula C36H43N5O6 and a molecular weight of 641.77 g/mol. Its IUPAC name is methyl 5-[[3-[[2-[(3-carbamoylphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]phenyl]carbamoyl]-2-methyl-8-phenyldecanoate.
| Compound Name | methyl 5-[[3-[[2-[(3-carbamoylphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]phenyl]carbamoyl]-2-methyl-8-phenyldecanoate |
|---|---|
| PubChem CID | 158214242 |
| Molecular Formula | C36H43N5O6 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | methyl 5-[[3-[[2-[(3-carbamoylphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]phenyl]carbamoyl]-2-methyl-8-phenyldecanoate |
| SMILES | CCC(CCC(CCC(C)C(=O)OC)C(=O)Nc1cccc(NC(=O)C(/N=N/c2cccc(C(N)=O)c2)=C(C)O)c1)c1ccccc1 |
| InChI | InChI=1S/C36H43N5O6/c1-5-25(26-11-7-6-8-12-26)19-20-27(18-17-23(2)36(46)47-4)34(44)38-29-14-10-15-30(22-29)39-35(45)32(24(3)42)41-40-31-16-9-13-28(21-31)33(37)43/h6-16,21-23,25,27,42H,5,17-20H2,1-4H3,(H2,37,43)(H,38,44)(H,39,45)/b32-24?,41-40+ |
| InChIKey | AYMOGMSLBSSSMS-HQVGIKPASA-N |
| XLogP | 7.42 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|