C11H17ClN2 — CID 123364710
(2E,4E)-6-chloro-N',3,4-trimethylocta-2,4,6-trienimidamide (PubChem CID 123364710) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is (2E,4E)-6-chloro-N',3,4-trimethylocta-2,4,6-trienimidamide.
| Compound Name | (2E,4E)-6-chloro-N',3,4-trimethylocta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 123364710 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (2E,4E)-6-chloro-N',3,4-trimethylocta-2,4,6-trienimidamide |
| SMILES | CC=C(Cl)/C=C(C)/C(C)=C/C(N)=N/C |
| InChI | InChI=1S/C11H17ClN2/c1-5-10(12)6-8(2)9(3)7-11(13)14-4/h5-7H,1-4H3,(H2,13,14)/b8-6+,9-7+,10-5? |
| InChIKey | DDXUICVTVMUGMP-AMUUDEJBSA-N |
| XLogP | 3.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|