C7H12N2 — CID 143198239
(2Z)-N',4-dimethylpenta-2,4-dienimidamide (PubChem CID 143198239) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (2Z)-N',4-dimethylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-N',4-dimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 143198239 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2Z)-N',4-dimethylpenta-2,4-dienimidamide |
| SMILES | C=C(C)/C=C\C(N)=N\C |
| InChI | InChI=1S/C7H12N2/c1-6(2)4-5-7(8)9-3/h4-5H,1H2,2-3H3,(H2,8,9)/b5-4- |
| InChIKey | MNIPSEPGCGLCCN-PLNGDYQASA-N |
| XLogP | 1.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|