C26H21F5N4O4S — CID 123368436
5-(1-amino-1-oxopentan-3-yl)-3-[2,6-difluoro-3-[N-sulfino-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 123368436) has the molecular formula C26H21F5N4O4S and a molecular weight of 580.54 g/mol. Its IUPAC name is 5-(1-amino-1-oxopentan-3-yl)-3-[2,6-difluoro-3-[N-sulfino-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(1-amino-1-oxopentan-3-yl)-3-[2,6-difluoro-3-[N-sulfino-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123368436 |
| Molecular Formula | C26H21F5N4O4S |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 5-(1-amino-1-oxopentan-3-yl)-3-[2,6-difluoro-3-[N-sulfino-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCC(CC(N)=O)c1cnc2[nH]cc(C(=O)c3c(F)ccc(N(c4ccc(C(F)(F)F)cc4)S(=O)O)c3F)c2c1 |
| InChI | InChI=1S/C26H21F5N4O4S/c1-2-13(10-21(32)36)14-9-17-18(12-34-25(17)33-11-14)24(37)22-19(27)7-8-20(23(22)28)35(40(38)39)16-5-3-15(4-6-16)26(29,30)31/h3-9,11-13H,2,10H2,1H3,(H2,32,36)(H,33,34)(H,38,39) |
| InChIKey | XWBCEDFDXLPHRM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|