About 1-methoxybutan-2-yl methanesulfinate
1-methoxybutan-2-yl methanesulfinate (PubChem CID 123369525) has the molecular formula C6H14O3S
and a molecular weight of 166.24 g/mol. Its IUPAC name is 1-methoxybutan-2-yl methanesulfinate.
Molecular Properties
| Compound Name | 1-methoxybutan-2-yl methanesulfinate |
| PubChem CID | 123369525 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-methoxybutan-2-yl methanesulfinate |
| SMILES | CCC(COC)OS(C)=O |
| InChI | InChI=1S/C6H14O3S/c1-4-6(5-8-2)9-10(3)7/h6H,4-5H2,1-3H3 |
| InChIKey | JHDLNUGBFUKJGT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxybutan-2-yl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxybutan-2-yl methanesulfinate?
The IUPAC name of 1-methoxybutan-2-yl methanesulfinate (CID 123369525) is 1-methoxybutan-2-yl methanesulfinate.
What is the SMILES notation for 1-methoxybutan-2-yl methanesulfinate?
The canonical SMILES for 1-methoxybutan-2-yl methanesulfinate is CCC(COC)OS(C)=O.
What is the InChIKey of 1-methoxybutan-2-yl methanesulfinate?
The InChIKey is JHDLNUGBFUKJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3S/c1-4-6(5-8-2)9-10(3)7/h6H,4-5H2,1-3H3.
What are the key properties of 1-methoxybutan-2-yl methanesulfinate?
1-methoxybutan-2-yl methanesulfinate has a molecular weight of 166.24 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxybutan-2-yl methanesulfinate is sourced from PubChem (CID 123369525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).