C17H31NO3 — CID 123370122
5-ethyl-9-methoxy-11,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol (PubChem CID 123370122) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 5-ethyl-9-methoxy-11,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol.
| Compound Name | 5-ethyl-9-methoxy-11,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol |
|---|---|
| PubChem CID | 123370122 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 5-ethyl-9-methoxy-11,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol |
| SMILES | CCN1CC=CC(OC)C(O)C(C)C=C(C)COCCC1 |
| InChI | InChI=1S/C17H31NO3/c1-5-18-9-6-8-16(20-4)17(19)15(3)12-14(2)13-21-11-7-10-18/h6,8,12,15-17,19H,5,7,9-11,13H2,1-4H3 |
| InChIKey | AKIQYOIEBPXMCN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|