C16H16N2O2 — CID 123372248
N-(1-phenylethyl)-3a,7a-dihydro-1,3-benzoxazole-2-carboxamide (PubChem CID 123372248) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(1-phenylethyl)-3a,7a-dihydro-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-(1-phenylethyl)-3a,7a-dihydro-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 123372248 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(1-phenylethyl)-3a,7a-dihydro-1,3-benzoxazole-2-carboxamide |
| SMILES | CC(NC(=O)C1=NC2C=CC=CC2O1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-11(12-7-3-2-4-8-12)17-15(19)16-18-13-9-5-6-10-14(13)20-16/h2-11,13-14H,1H3,(H,17,19) |
| InChIKey | LNDGTCZRLRDKCS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |