C33H54O15S — CID 123373946
2-butan-2-yl-6-(hydroxymethyl)-2-[[3,4,5-trihydroxy-6-[3-[(3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl)methoxy]pentan-3-yl]oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 123373946) has the molecular formula C33H54O15S and a molecular weight of 722.85 g/mol. Its IUPAC name is 2-butan-2-yl-6-(hydroxymethyl)-2-[[3,4,5-trihydroxy-6-[3-[(3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl)methoxy]pentan-3-yl]oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | 2-butan-2-yl-6-(hydroxymethyl)-2-[[3,4,5-trihydroxy-6-[3-[(3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl)methoxy]pentan-3-yl]oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123373946 |
| Molecular Formula | C33H54O15S |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.32 |
| IUPAC Name | 2-butan-2-yl-6-(hydroxymethyl)-2-[[3,4,5-trihydroxy-6-[3-[(3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl)methoxy]pentan-3-yl]oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CCC(C)C1(OCC2OC(C(CC)(CC)OCC3OC(Sc4ccccc4)C(O)C(O)C3O)C(O)C(O)C2O)OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C33H54O15S/c1-5-16(4)33(29(43)26(40)21(35)18(13-34)48-33)45-15-19-22(36)24(38)27(41)30(46-19)32(6-2,7-3)44-14-20-23(37)25(39)28(42)31(47-20)49-17-11-9-8-10-12-17/h8-12,16,18-31,34-43H,5-7,13-15H2,1-4H3 |
| InChIKey | LDVDCGRTJKDALR-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 248.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |