C15H28N4O4 — CID 123375259
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-2-cyclohexylacetyl]amino]butanamide (PubChem CID 123375259) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-2-cyclohexylacetyl]amino]butanamide.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-2-cyclohexylacetyl]amino]butanamide |
|---|---|
| PubChem CID | 123375259 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-2-cyclohexylacetyl]amino]butanamide |
| SMILES | CCC(NC(=O)C(NC(=O)C(N)CO)C1CCCCC1)C(N)=O |
| InChI | InChI=1S/C15H28N4O4/c1-2-11(13(17)21)18-15(23)12(9-6-4-3-5-7-9)19-14(22)10(16)8-20/h9-12,20H,2-8,16H2,1H3,(H2,17,21)(H,18,23)(H,19,22) |
| InChIKey | FDQUWDLXXYKPHD-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |