C25H28FN3O6S — CID 123375829
ethyl 2-[(3S)-6-fluoro-3-[(4-nitrophenyl)sulfonyl-propylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 123375829) has the molecular formula C25H28FN3O6S and a molecular weight of 517.58 g/mol. Its IUPAC name is ethyl 2-[(3S)-6-fluoro-3-[(4-nitrophenyl)sulfonyl-propylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[(3S)-6-fluoro-3-[(4-nitrophenyl)sulfonyl-propylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 123375829 |
| Molecular Formula | C25H28FN3O6S |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | ethyl 2-[(3S)-6-fluoro-3-[(4-nitrophenyl)sulfonyl-propylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCCN([C@H]1CCc2c(c3cc(F)ccc3n2CC(=O)OCC)C1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28FN3O6S/c1-3-13-28(36(33,34)20-9-6-18(7-10-20)29(31)32)19-8-12-24-22(15-19)21-14-17(26)5-11-23(21)27(24)16-25(30)35-4-2/h5-7,9-11,14,19H,3-4,8,12-13,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZVCQYPRAMGOJGA-IBGZPJMESA-N |
| XLogP | 4.21 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|