C11H22N2O3S — CID 123378597
[3,4-dihydroxy-5-(1-hydroxyethyl)cyclohexyl] N,N-dimethylcarbamimidothioate (PubChem CID 123378597) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(1-hydroxyethyl)cyclohexyl] N,N-dimethylcarbamimidothioate.
| Compound Name | [3,4-dihydroxy-5-(1-hydroxyethyl)cyclohexyl] N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 123378597 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [3,4-dihydroxy-5-(1-hydroxyethyl)cyclohexyl] N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(/SC1CC(O)C(O)C(C(C)O)C1)N(C)C |
| InChI | InChI=1S/C11H22N2O3S/c1-6(14)8-4-7(5-9(15)10(8)16)17-11(12)13(2)3/h6-10,12,14-16H,4-5H2,1-3H3/b12-11+ |
| InChIKey | BSBYRJXQIFAGTG-VAWYXSNFSA-N |
| XLogP | 0.10 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|