C11H21N2O3S+ — CID 123911317
[[3,4-dihydroxy-5-(hydroxymethyl)cyclohexyl]sulfanyl-(dimethylamino)methylidene]-methylideneazanium (PubChem CID 123911317) has the molecular formula C11H21N2O3S+ and a molecular weight of 261.37 g/mol. Its IUPAC name is [[3,4-dihydroxy-5-(hydroxymethyl)cyclohexyl]sulfanyl-(dimethylamino)methylidene]-methylideneazanium.
| Compound Name | [[3,4-dihydroxy-5-(hydroxymethyl)cyclohexyl]sulfanyl-(dimethylamino)methylidene]-methylideneazanium |
|---|---|
| PubChem CID | 123911317 |
| Molecular Formula | C11H21N2O3S+ |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | [[3,4-dihydroxy-5-(hydroxymethyl)cyclohexyl]sulfanyl-(dimethylamino)methylidene]-methylideneazanium |
| SMILES | C=[N+]=C(SC1CC(O)C(O)C(CO)C1)N(C)C |
| InChI | InChI=1S/C11H21N2O3S/c1-12-11(13(2)3)17-8-4-7(6-14)10(16)9(15)5-8/h7-10,14-16H,1,4-6H2,2-3H3/q+1 |
| InChIKey | MHZADXSTOZXRMZ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|