C9H17N2O4S+ — CID 123949925
[[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(methylamino)methylidene]-methylideneazanium (PubChem CID 123949925) has the molecular formula C9H17N2O4S+ and a molecular weight of 249.31 g/mol. Its IUPAC name is [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(methylamino)methylidene]-methylideneazanium.
| Compound Name | [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(methylamino)methylidene]-methylideneazanium |
|---|---|
| PubChem CID | 123949925 |
| Molecular Formula | C9H17N2O4S+ |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(methylamino)methylidene]-methylideneazanium |
| SMILES | C=[N+]=C(NC)SC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C9H16N2O4S/c1-10-9(11-2)16-7-3-5(13)8(14)6(4-12)15-7/h5-8,12-14H,1,3-4H2,2H3/p+1 |
| InChIKey | ZELKNTFUPURXRR-UHFFFAOYSA-O |
| XLogP | -2.11 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|