C10H18N2O4S — CID 126708481
[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] azetidine-1-carboximidothioate (PubChem CID 126708481) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] azetidine-1-carboximidothioate.
| Compound Name | [(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] azetidine-1-carboximidothioate |
|---|---|
| PubChem CID | 126708481 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] azetidine-1-carboximidothioate |
| SMILES | [H]/N=C(/S[C@@H]1C[C@@H](O)[C@H](O)[C@@H](CO)O1)N1CCC1 |
| InChI | InChI=1S/C10H18N2O4S/c11-10(12-2-1-3-12)17-8-4-6(14)9(15)7(5-13)16-8/h6-9,11,13-15H,1-5H2/b11-10+/t6-,7-,8-,9+/m1/s1 |
| InChIKey | QSFRDGDSEBFIFJ-JQNQDSCZSA-N |
| XLogP | -0.81 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|