About [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium
[[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium (PubChem CID 123855526) has the molecular formula C10H19N2O4S+
and a molecular weight of 263.34 g/mol. Its IUPAC name is [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium.
Molecular Properties
| Compound Name | [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium |
| PubChem CID | 123855526 |
| Molecular Formula | C10H19N2O4S+ |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium |
| SMILES | C=[N+]=C(NCC)SC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C10H18N2O4S/c1-3-12-10(11-2)17-8-4-6(14)9(15)7(5-13)16-8/h6-9,13-15H,2-5H2,1H3/p+1 |
| InChIKey | XTPKEITWVCBBRU-UHFFFAOYSA-O |
| XLogP | -1.72 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium?
The IUPAC name of [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium (CID 123855526) is [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium.
What is the SMILES notation for [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium?
The canonical SMILES for [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium is C=[N+]=C(NCC)SC1CC(O)C(O)C(CO)O1.
What is the InChIKey of [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium?
The InChIKey is XTPKEITWVCBBRU-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H18N2O4S/c1-3-12-10(11-2)17-8-4-6(14)9(15)7(5-13)16-8/h6-9,13-15H,2-5H2,1H3/p+1.
What are the key properties of [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium?
[[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium has a molecular weight of 263.34 g/mol, XLogP of -1.72, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-(ethylamino)methylidene]-methylideneazanium is sourced from PubChem (CID 123855526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).