C12H24N2O4 — CID 144532345
N,N-dimethyl-N'-[(1S,2R,3R,4R,6S)-2,3,6-trihydroxy-4-[(1S)-1-hydroxyethyl]cyclohexyl]ethanimidamide (PubChem CID 144532345) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(1S,2R,3R,4R,6S)-2,3,6-trihydroxy-4-[(1S)-1-hydroxyethyl]cyclohexyl]ethanimidamide.
| Compound Name | N,N-dimethyl-N'-[(1S,2R,3R,4R,6S)-2,3,6-trihydroxy-4-[(1S)-1-hydroxyethyl]cyclohexyl]ethanimidamide |
|---|---|
| PubChem CID | 144532345 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N,N-dimethyl-N'-[(1S,2R,3R,4R,6S)-2,3,6-trihydroxy-4-[(1S)-1-hydroxyethyl]cyclohexyl]ethanimidamide |
| SMILES | C/C(=N\[C@@H]1[C@@H](O)[C@H](O)[C@@H]([C@H](C)O)C[C@@H]1O)N(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-6(15)8-5-9(16)10(12(18)11(8)17)13-7(2)14(3)4/h6,8-12,15-18H,5H2,1-4H3/b13-7+/t6-,8+,9-,10-,11+,12+/m0/s1 |
| InChIKey | YCOOJXKEBNNVHA-LIEYRNBGSA-N |
| XLogP | -1.18 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|