C17H14S3 — CID 123380682
13-but-1-enyl-12-methyl-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene (PubChem CID 123380682) has the molecular formula C17H14S3 and a molecular weight of 314.50 g/mol. Its IUPAC name is 13-but-1-enyl-12-methyl-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene.
| Compound Name | 13-but-1-enyl-12-methyl-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
|---|---|
| PubChem CID | 123380682 |
| Molecular Formula | C17H14S3 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 13-but-1-enyl-12-methyl-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
| SMILES | CCC=Cc1c(C)sc2c1sc1c3ccccc3sc21 |
| InChI | InChI=1S/C17H14S3/c1-3-4-7-11-10(2)18-16-14(11)20-15-12-8-5-6-9-13(12)19-17(15)16/h4-9H,3H2,1-2H3 |
| InChIKey | KEGHLVIYROUNMM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |