C18H12S3 — CID 139393949
(12E,13E)-12,13-bis(prop-2-enylidene)-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14)-pentaene (PubChem CID 139393949) has the molecular formula C18H12S3 and a molecular weight of 324.50 g/mol. Its IUPAC name is (12E,13E)-12,13-bis(prop-2-enylidene)-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14)-pentaene.
| Compound Name | (12E,13E)-12,13-bis(prop-2-enylidene)-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14)-pentaene |
|---|---|
| PubChem CID | 139393949 |
| Molecular Formula | C18H12S3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (12E,13E)-12,13-bis(prop-2-enylidene)-8,11,15-trithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14)-pentaene |
| SMILES | C=C/C=c1\c(=C/C=C)sc2c1sc1c3ccccc3sc21 |
| InChI | InChI=1S/C18H12S3/c1-3-7-11-13(8-4-2)19-17-15(11)21-16-12-9-5-6-10-14(12)20-18(16)17/h3-10H,1-2H2/b11-7+,13-8+ |
| InChIKey | DEENVXWJBWGARY-ZHSLHGDYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |